C11H13ClOS — CID 154635046
(Z)-3-chloro-4,4-dimethyl-1-thiophen-2-ylpent-2-en-1-one (PubChem CID 154635046) has the molecular formula C11H13ClOS and a molecular weight of 228.74 g/mol. Its IUPAC name is (Z)-3-chloro-4,4-dimethyl-1-thiophen-2-ylpent-2-en-1-one.
| Compound Name | (Z)-3-chloro-4,4-dimethyl-1-thiophen-2-ylpent-2-en-1-one |
|---|---|
| PubChem CID | 154635046 |
| Molecular Formula | C11H13ClOS |
| Molecular Weight | 228.74 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | (Z)-3-chloro-4,4-dimethyl-1-thiophen-2-ylpent-2-en-1-one |
| SMILES | CC(C)(C)/C(Cl)=C/C(=O)c1cccs1 |
| InChI | InChI=1S/C11H13ClOS/c1-11(2,3)10(12)7-8(13)9-5-4-6-14-9/h4-7H,1-3H3/b10-7- |
| InChIKey | QGUNRPLLHWXDAM-YFHOEESVSA-N |
| XLogP | 4.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|