C23H21N3O6S — CID 154637016
3,5-bis(4-methoxyphenyl)-2-(4-nitrophenyl)sulfonyl-3,4-dihydropyrazole (PubChem CID 154637016) has the molecular formula C23H21N3O6S and a molecular weight of 467.50 g/mol. Its IUPAC name is 3,5-bis(4-methoxyphenyl)-2-(4-nitrophenyl)sulfonyl-3,4-dihydropyrazole.
| Compound Name | 3,5-bis(4-methoxyphenyl)-2-(4-nitrophenyl)sulfonyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 154637016 |
| Molecular Formula | C23H21N3O6S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 3,5-bis(4-methoxyphenyl)-2-(4-nitrophenyl)sulfonyl-3,4-dihydropyrazole |
| SMILES | COc1ccc(C2=NN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)C(c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C23H21N3O6S/c1-31-19-9-3-16(4-10-19)22-15-23(17-5-11-20(32-2)12-6-17)25(24-22)33(29,30)21-13-7-18(8-14-21)26(27)28/h3-14,23H,15H2,1-2H3 |
| InChIKey | RKORROZOVYSAQR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|