C23H22N4O7S2 — CID 44885228
N-[3-[2-(4-methoxyphenyl)sulfonyl-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]methanesulfonamide (PubChem CID 44885228) has the molecular formula C23H22N4O7S2 and a molecular weight of 530.58 g/mol. Its IUPAC name is N-[3-[2-(4-methoxyphenyl)sulfonyl-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[2-(4-methoxyphenyl)sulfonyl-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 44885228 |
| Molecular Formula | C23H22N4O7S2 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | N-[3-[2-(4-methoxyphenyl)sulfonyl-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]methanesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N2N=C(c3cccc(NS(C)(=O)=O)c3)CC2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H22N4O7S2/c1-34-20-9-11-21(12-10-20)36(32,33)26-23(17-6-4-8-19(14-17)27(28)29)15-22(24-26)16-5-3-7-18(13-16)25-35(2,30)31/h3-14,23,25H,15H2,1-2H3 |
| InChIKey | HSGAKHUOBWIXFZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 148.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|