C18H20N4O6S2 — CID 27655974
N-[3-[(3S)-2-ethylsulfonyl-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]methanesulfonamide (PubChem CID 27655974) has the molecular formula C18H20N4O6S2 and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[3-[(3S)-2-ethylsulfonyl-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(3S)-2-ethylsulfonyl-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 27655974 |
| Molecular Formula | C18H20N4O6S2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-[3-[(3S)-2-ethylsulfonyl-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]methanesulfonamide |
| SMILES | CCS(=O)(=O)N1N=C(c2cccc(NS(C)(=O)=O)c2)C[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20N4O6S2/c1-3-30(27,28)21-18(14-7-5-9-16(11-14)22(23)24)12-17(19-21)13-6-4-8-15(10-13)20-29(2,25)26/h4-11,18,20H,3,12H2,1-2H3/t18-/m0/s1 |
| InChIKey | JUOHYYXROUBDBJ-SFHVURJKSA-N |
| XLogP | 2.47 |
| TPSA | 139.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|