C24H25ClF3N5O — CID 154638512
(5S)-8-chloro-1-(4-pyridin-2-yloxycyclohexyl)-N-(2,2,2-trifluoroethyl)-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-5-amine (PubChem CID 154638512) has the molecular formula C24H25ClF3N5O and a molecular weight of 491.95 g/mol. Its IUPAC name is (5S)-8-chloro-1-(4-pyridin-2-yloxycyclohexyl)-N-(2,2,2-trifluoroethyl)-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-5-amine.
| Compound Name | (5S)-8-chloro-1-(4-pyridin-2-yloxycyclohexyl)-N-(2,2,2-trifluoroethyl)-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-5-amine |
|---|---|
| PubChem CID | 154638512 |
| Molecular Formula | C24H25ClF3N5O |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (5S)-8-chloro-1-(4-pyridin-2-yloxycyclohexyl)-N-(2,2,2-trifluoroethyl)-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-5-amine |
| SMILES | FC(F)(F)CN[C@H]1Cc2cc(Cl)ccc2-n2c(nnc2C2CCC(Oc3ccccn3)CC2)C1 |
| InChI | InChI=1S/C24H25ClF3N5O/c25-17-6-9-20-16(11-17)12-18(30-14-24(26,27)28)13-21-31-32-23(33(20)21)15-4-7-19(8-5-15)34-22-3-1-2-10-29-22/h1-3,6,9-11,15,18-19,30H,4-5,7-8,12-14H2/t15?,18-,19?/m0/s1 |
| InChIKey | CCOLEDMRSSKOEP-OBONGRFPSA-N |
| XLogP | 5.04 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |