C25H29ClN6O2 — CID 154638701
3-[8-chloro-1-(4-pyridin-2-yloxycyclohexyl)-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-5-yl]-1,1-dimethylurea (PubChem CID 154638701) has the molecular formula C25H29ClN6O2 and a molecular weight of 481.00 g/mol. Its IUPAC name is 3-[8-chloro-1-(4-pyridin-2-yloxycyclohexyl)-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-5-yl]-1,1-dimethylurea.
| Compound Name | 3-[8-chloro-1-(4-pyridin-2-yloxycyclohexyl)-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-5-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 154638701 |
| Molecular Formula | C25H29ClN6O2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3-[8-chloro-1-(4-pyridin-2-yloxycyclohexyl)-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-5-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1Cc2cc(Cl)ccc2-n2c(nnc2C2CCC(Oc3ccccn3)CC2)C1 |
| InChI | InChI=1S/C25H29ClN6O2/c1-31(2)25(33)28-19-14-17-13-18(26)8-11-21(17)32-22(15-19)29-30-24(32)16-6-9-20(10-7-16)34-23-5-3-4-12-27-23/h3-5,8,11-13,16,19-20H,6-7,9-10,14-15H2,1-2H3,(H,28,33) |
| InChIKey | HNJLKJNKEKPBLF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |