C34H50N4O2 — CID 154639349
N-[1-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-4-yl]-1,2,2,6,6-pentamethylpiperidin-4-amine (PubChem CID 154639349) has the molecular formula C34H50N4O2 and a molecular weight of 546.80 g/mol. Its IUPAC name is N-[1-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-4-yl]-1,2,2,6,6-pentamethylpiperidin-4-amine.
| Compound Name | N-[1-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-4-yl]-1,2,2,6,6-pentamethylpiperidin-4-amine |
|---|---|
| PubChem CID | 154639349 |
| Molecular Formula | C34H50N4O2 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.39 |
| IUPAC Name | N-[1-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-4-yl]-1,2,2,6,6-pentamethylpiperidin-4-amine |
| SMILES | COc1ccc(-c2[nH]c3ccc(N4CCC(NC5CC(C)(C)N(C)C(C)(C)C5)CC4)cc3c2C(C)C)cc1OC |
| InChI | InChI=1S/C34H50N4O2/c1-22(2)31-27-19-26(11-12-28(27)36-32(31)23-10-13-29(39-8)30(18-23)40-9)38-16-14-24(15-17-38)35-25-20-33(3,4)37(7)34(5,6)21-25/h10-13,18-19,22,24-25,35-36H,14-17,20-21H2,1-9H3 |
| InChIKey | SZMWGZWWZHFZLS-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 52.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |