C18H17Cl2N7 — CID 154640320
6-(4-amino-4-methylpiperidin-1-yl)-3-(2,3-dichloro-4-pyridinyl)-2H-pyrazolo[3,4-b]pyridine-4-carbonitrile (PubChem CID 154640320) has the molecular formula C18H17Cl2N7 and a molecular weight of 402.29 g/mol. Its IUPAC name is 6-(4-amino-4-methylpiperidin-1-yl)-3-(2,3-dichloro-4-pyridinyl)-2H-pyrazolo[3,4-b]pyridine-4-carbonitrile.
| Compound Name | 6-(4-amino-4-methylpiperidin-1-yl)-3-(2,3-dichloro-4-pyridinyl)-2H-pyrazolo[3,4-b]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 154640320 |
| Molecular Formula | C18H17Cl2N7 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 6-(4-amino-4-methylpiperidin-1-yl)-3-(2,3-dichloro-4-pyridinyl)-2H-pyrazolo[3,4-b]pyridine-4-carbonitrile |
| SMILES | CC1(N)CCN(c2cc(C#N)c3c(-c4ccnc(Cl)c4Cl)[nH]nc3n2)CC1 |
| InChI | InChI=1S/C18H17Cl2N7/c1-18(22)3-6-27(7-4-18)12-8-10(9-21)13-15(25-26-17(13)24-12)11-2-5-23-16(20)14(11)19/h2,5,8H,3-4,6-7,22H2,1H3,(H,24,25,26) |
| InChIKey | ATTDACYSELGDAD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 107.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|