C17H19Cl2N7 — CID 154640341
6-(4-amino-4-methylpiperidin-1-yl)-3-(2,3-dichloro-4-pyridinyl)-2H-pyrazolo[3,4-b]pyridin-4-amine (PubChem CID 154640341) has the molecular formula C17H19Cl2N7 and a molecular weight of 392.29 g/mol. Its IUPAC name is 6-(4-amino-4-methylpiperidin-1-yl)-3-(2,3-dichloro-4-pyridinyl)-2H-pyrazolo[3,4-b]pyridin-4-amine.
| Compound Name | 6-(4-amino-4-methylpiperidin-1-yl)-3-(2,3-dichloro-4-pyridinyl)-2H-pyrazolo[3,4-b]pyridin-4-amine |
|---|---|
| PubChem CID | 154640341 |
| Molecular Formula | C17H19Cl2N7 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 6-(4-amino-4-methylpiperidin-1-yl)-3-(2,3-dichloro-4-pyridinyl)-2H-pyrazolo[3,4-b]pyridin-4-amine |
| SMILES | CC1(N)CCN(c2cc(N)c3c(-c4ccnc(Cl)c4Cl)[nH]nc3n2)CC1 |
| InChI | InChI=1S/C17H19Cl2N7/c1-17(21)3-6-26(7-4-17)11-8-10(20)12-14(24-25-16(12)23-11)9-2-5-22-15(19)13(9)18/h2,5,8H,3-4,6-7,21H2,1H3,(H3,20,23,24,25) |
| InChIKey | MXCUSBBPPBJUJW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|