About 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid
6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid (PubChem CID 154641602) has the molecular formula C8H6O6
and a molecular weight of 198.13 g/mol. Its IUPAC name is 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
| PubChem CID | 154641602 |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C12C=CC=CC1(C(=O)OO)O2 |
| InChI | InChI=1S/C8H6O6/c9-5(10)7-3-1-2-4-8(7,14-7)6(11)13-12/h1-4,12H,(H,9,10) |
| InChIKey | IFJDJZIYLOWDJY-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid (CID 154641602) is 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid is O=C(O)C12C=CC=CC1(C(=O)OO)O2.
What is the InChIKey of 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid?
The InChIKey is IFJDJZIYLOWDJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O6/c9-5(10)7-3-1-2-4-8(7,14-7)6(11)13-12/h1-4,12H,(H,9,10).
What are the key properties of 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid?
6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid has a molecular weight of 198.13 g/mol, XLogP of -0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 154641602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).