C8H6O6 — CID 154641602
6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid (PubChem CID 154641602) has the molecular formula C8H6O6 and a molecular weight of 198.13 g/mol. Its IUPAC name is 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid.
| Compound Name | 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 154641602 |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 6-carbonoperoxoyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C12C=CC=CC1(C(=O)OO)O2 |
| InChI | InChI=1S/C8H6O6/c9-5(10)7-3-1-2-4-8(7,14-7)6(11)13-12/h1-4,12H,(H,9,10) |
| InChIKey | IFJDJZIYLOWDJY-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|