C32H26FN5O2 — CID 154641927
N-[(3S,4Z)-4-benzylidene-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]pyridine-3-carboxamide (PubChem CID 154641927) has the molecular formula C32H26FN5O2 and a molecular weight of 531.59 g/mol. Its IUPAC name is N-[(3S,4Z)-4-benzylidene-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]pyridine-3-carboxamide.
| Compound Name | N-[(3S,4Z)-4-benzylidene-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154641927 |
| Molecular Formula | C32H26FN5O2 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | N-[(3S,4Z)-4-benzylidene-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]pyridine-3-carboxamide |
| SMILES | CCC1[C@@H](NC(=O)c2cccnc2)/C(=C/c2ccccc2)C(=O)N1c1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C32H26FN5O2/c1-2-28-30(36-31(39)22-9-6-16-34-19-22)27(17-21-7-4-3-5-8-21)32(40)37(28)26-14-15-29-23(18-26)20-35-38(29)25-12-10-24(33)11-13-25/h3-20,28,30H,2H2,1H3,(H,36,39)/b27-17-/t28?,30-/m0/s1 |
| InChIKey | UWQLCNFHINEHNS-QDQJWHNVSA-N |
| XLogP | 5.57 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|