C13H9BF2N2O2S2 — CID 154643125
CID 154643125 (PubChem CID 154643125) has the molecular formula C13H9BF2N2O2S2 and a molecular weight of 338.17 g/mol.
| Compound Name | CID 154643125 |
|---|---|
| PubChem CID | 154643125 |
| Molecular Formula | C13H9BF2N2O2S2 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | — |
| SMILES | [B]C(O)(SF)Sc1cc(NC(=O)c2ccccn2)ccc1F |
| InChI | InChI=1S/C13H9BF2N2O2S2/c14-13(20,22-16)21-11-7-8(4-5-9(11)15)18-12(19)10-3-1-2-6-17-10/h1-7,20H,(H,18,19) |
| InChIKey | CRBFQCFUDOQWGN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|