C23H25F2N5O — CID 154643902
ethane;1-[4-[8-fluoro-7-(2-fluorophenyl)pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 154643902) has the molecular formula C23H25F2N5O and a molecular weight of 425.48 g/mol. Its IUPAC name is ethane;1-[4-[8-fluoro-7-(2-fluorophenyl)pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | ethane;1-[4-[8-fluoro-7-(2-fluorophenyl)pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154643902 |
| Molecular Formula | C23H25F2N5O |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | ethane;1-[4-[8-fluoro-7-(2-fluorophenyl)pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(F)c(-c4ccccc4F)ncc23)C(C)C1.CC |
| InChI | InChI=1S/C21H19F2N5O.C2H6/c1-3-17(29)27-8-9-28(13(2)11-27)21-15-10-24-19(14-6-4-5-7-16(14)22)18(23)20(15)25-12-26-21;1-2/h3-7,10,12-13H,1,8-9,11H2,2H3;1-2H3 |
| InChIKey | OEQJWORSPGFULK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|