C12H12Cl2FN5 — CID 154643976
2,7-dichloro-8-fluoro-4-(4-methylpiperazin-1-yl)pyrido[4,3-d]pyrimidine (PubChem CID 154643976) has the molecular formula C12H12Cl2FN5 and a molecular weight of 316.17 g/mol. Its IUPAC name is 2,7-dichloro-8-fluoro-4-(4-methylpiperazin-1-yl)pyrido[4,3-d]pyrimidine.
| Compound Name | 2,7-dichloro-8-fluoro-4-(4-methylpiperazin-1-yl)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 154643976 |
| Molecular Formula | C12H12Cl2FN5 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2,7-dichloro-8-fluoro-4-(4-methylpiperazin-1-yl)pyrido[4,3-d]pyrimidine |
| SMILES | CN1CCN(c2nc(Cl)nc3c(F)c(Cl)ncc23)CC1 |
| InChI | InChI=1S/C12H12Cl2FN5/c1-19-2-4-20(5-3-19)11-7-6-16-10(13)8(15)9(7)17-12(14)18-11/h6H,2-5H2,1H3 |
| InChIKey | OJJAKRGCJUJKQX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|