C17H24N2O3 — CID 154645973
4-[1-(4-ethylpiperazin-1-yl)-2-methyl-1-oxopropan-2-yl]oxybenzaldehyde (PubChem CID 154645973) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[1-(4-ethylpiperazin-1-yl)-2-methyl-1-oxopropan-2-yl]oxybenzaldehyde.
| Compound Name | 4-[1-(4-ethylpiperazin-1-yl)-2-methyl-1-oxopropan-2-yl]oxybenzaldehyde |
|---|---|
| PubChem CID | 154645973 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 4-[1-(4-ethylpiperazin-1-yl)-2-methyl-1-oxopropan-2-yl]oxybenzaldehyde |
| SMILES | CCN1CCN(C(=O)C(C)(C)Oc2ccc(C=O)cc2)CC1 |
| InChI | InChI=1S/C17H24N2O3/c1-4-18-9-11-19(12-10-18)16(21)17(2,3)22-15-7-5-14(13-20)6-8-15/h5-8,13H,4,9-12H2,1-3H3 |
| InChIKey | QHSZEGCPMVHDLM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|