C43H28N6 — CID 154646495
6-(2,6-diphenylpyrimidin-4-yl)-11,19-diphenyl-2,9,11,19-tetrazapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),3(8),4,6,9,13,15,17-octaene (PubChem CID 154646495) has the molecular formula C43H28N6 and a molecular weight of 628.74 g/mol. Its IUPAC name is 6-(2,6-diphenylpyrimidin-4-yl)-11,19-diphenyl-2,9,11,19-tetrazapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),3(8),4,6,9,13,15,17-octaene.
| Compound Name | 6-(2,6-diphenylpyrimidin-4-yl)-11,19-diphenyl-2,9,11,19-tetrazapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),3(8),4,6,9,13,15,17-octaene |
|---|---|
| PubChem CID | 154646495 |
| Molecular Formula | C43H28N6 |
| Molecular Weight | 628.74 g/mol |
| Exact Mass | 628.24 |
| IUPAC Name | 6-(2,6-diphenylpyrimidin-4-yl)-11,19-diphenyl-2,9,11,19-tetrazapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),3(8),4,6,9,13,15,17-octaene |
| SMILES | c1ccc(-c2cc(-c3ccc4c(c3)nc3n(-c5ccccc5)c5c6ccccc6n(-c6ccccc6)c5n43)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C43H28N6/c1-5-15-29(16-6-1)35-28-36(45-41(44-35)30-17-7-2-8-18-30)31-25-26-39-37(27-31)46-43-48(33-21-11-4-12-22-33)40-34-23-13-14-24-38(34)47(42(40)49(39)43)32-19-9-3-10-20-32/h1-28H |
| InChIKey | HZMKTZQRKIOICC-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 52.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.74 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |