C48H31N7 — CID 164745048
6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11,19-diphenyl-2,9,11,19-tetrazapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),3(8),4,6,9,13,15,17-octaene (PubChem CID 164745048) has the molecular formula C48H31N7 and a molecular weight of 705.83 g/mol. Its IUPAC name is 6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11,19-diphenyl-2,9,11,19-tetrazapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),3(8),4,6,9,13,15,17-octaene.
| Compound Name | 6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11,19-diphenyl-2,9,11,19-tetrazapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),3(8),4,6,9,13,15,17-octaene |
|---|---|
| PubChem CID | 164745048 |
| Molecular Formula | C48H31N7 |
| Molecular Weight | 705.83 g/mol |
| Exact Mass | 705.26 |
| IUPAC Name | 6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11,19-diphenyl-2,9,11,19-tetrazapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),3(8),4,6,9,13,15,17-octaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5c(c4)nc4n(-c6ccccc6)c6c7ccccc7n(-c7ccccc7)c6n54)cc3)n2)cc1 |
| InChI | InChI=1S/C48H31N7/c1-5-15-33(16-6-1)44-50-45(34-17-7-2-8-18-34)52-46(51-44)35-27-25-32(26-28-35)36-29-30-42-40(31-36)49-48-54(38-21-11-4-12-22-38)43-39-23-13-14-24-41(39)53(47(43)55(42)48)37-19-9-3-10-20-37/h1-31H |
| InChIKey | BKAGQXQEPCUDBH-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.83 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |