C26H22N4 — CID 154646800
11,12-bis(ethenyl)-13-[(3E)-penta-1,3-dien-3-yl]-8-phenyl-8,10,13,15-tetrazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene (PubChem CID 154646800) has the molecular formula C26H22N4 and a molecular weight of 390.49 g/mol. Its IUPAC name is 11,12-bis(ethenyl)-13-[(3E)-penta-1,3-dien-3-yl]-8-phenyl-8,10,13,15-tetrazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene.
| Compound Name | 11,12-bis(ethenyl)-13-[(3E)-penta-1,3-dien-3-yl]-8-phenyl-8,10,13,15-tetrazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene |
|---|---|
| PubChem CID | 154646800 |
| Molecular Formula | C26H22N4 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 11,12-bis(ethenyl)-13-[(3E)-penta-1,3-dien-3-yl]-8-phenyl-8,10,13,15-tetrazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene |
| SMILES | C=C/C(=C\C)n1c(C=C)c(C=C)n2c1nc1c3ccccc3n(-c3ccccc3)c12 |
| InChI | InChI=1S/C26H22N4/c1-5-18(6-2)29-21(7-3)22(8-4)30-25-24(27-26(29)30)20-16-12-13-17-23(20)28(25)19-14-10-9-11-15-19/h5-17H,1,3-4H2,2H3/b18-6+ |
| InChIKey | WMOZMGHROQUEDP-NGYBGAFCSA-N |
| XLogP | 6.57 |
| TPSA | 27.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|