C23H34N4OS — CID 154648194
1-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1-N'-[[(E)-2-[(2R)-1-propylpyrrolidin-2-yl]ethenyl]sulfonimidoyl]ethene-1,1-diamine (PubChem CID 154648194) has the molecular formula C23H34N4OS and a molecular weight of 414.62 g/mol. Its IUPAC name is 1-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1-N'-[[(E)-2-[(2R)-1-propylpyrrolidin-2-yl]ethenyl]sulfonimidoyl]ethene-1,1-diamine.
| Compound Name | 1-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1-N'-[[(E)-2-[(2R)-1-propylpyrrolidin-2-yl]ethenyl]sulfonimidoyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 154648194 |
| Molecular Formula | C23H34N4OS |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 1-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1-N'-[[(E)-2-[(2R)-1-propylpyrrolidin-2-yl]ethenyl]sulfonimidoyl]ethene-1,1-diamine |
| SMILES | [H]N=S(=O)(/C=C/[C@H]1CCCN1CCC)NC(=C)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C23H34N4OS/c1-3-13-27-14-6-9-20(27)12-15-29(24,28)26-17(2)25-23-21-10-4-7-18(21)16-19-8-5-11-22(19)23/h12,15-16,20,25H,2-11,13-14H2,1H3,(H2,24,26,28)/b15-12+/t20-,29?/m1/s1 |
| InChIKey | BWPDRFLACSJZIG-GBJJXNKWSA-N |
| XLogP | 4.49 |
| TPSA | 68.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |