C17H15N7 — CID 154649438
7-(1H-pyrazol-5-yl)-4-N-(pyridin-3-ylmethyl)quinazoline-2,4-diamine (PubChem CID 154649438) has the molecular formula C17H15N7 and a molecular weight of 317.36 g/mol. Its IUPAC name is 7-(1H-pyrazol-5-yl)-4-N-(pyridin-3-ylmethyl)quinazoline-2,4-diamine.
| Compound Name | 7-(1H-pyrazol-5-yl)-4-N-(pyridin-3-ylmethyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 154649438 |
| Molecular Formula | C17H15N7 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 7-(1H-pyrazol-5-yl)-4-N-(pyridin-3-ylmethyl)quinazoline-2,4-diamine |
| SMILES | Nc1nc(NCc2cccnc2)c2ccc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C17H15N7/c18-17-22-15-8-12(14-5-7-21-24-14)3-4-13(15)16(23-17)20-10-11-2-1-6-19-9-11/h1-9H,10H2,(H,21,24)(H3,18,20,22,23) |
| InChIKey | HIEKFZLLJGYACH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |