C16H18N6O — CID 154649288
[3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]cyclobutyl]methanol (PubChem CID 154649288) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is [3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]cyclobutyl]methanol.
| Compound Name | [3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]cyclobutyl]methanol |
|---|---|
| PubChem CID | 154649288 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]cyclobutyl]methanol |
| SMILES | Nc1nc(NC2CC(CO)C2)c2ccc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C16H18N6O/c17-16-20-14-7-10(13-3-4-18-22-13)1-2-12(14)15(21-16)19-11-5-9(6-11)8-23/h1-4,7,9,11,23H,5-6,8H2,(H,18,22)(H3,17,19,20,21) |
| InChIKey | QDBDMAMBWWMMBW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |