C19H22N6O5 — CID 154651071
4-(2-amino-3-hydroxypropanoyl)-N-[1-(4-formylphenyl)-2-oxopyrimidin-4-yl]piperazine-1-carboxamide (PubChem CID 154651071) has the molecular formula C19H22N6O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is 4-(2-amino-3-hydroxypropanoyl)-N-[1-(4-formylphenyl)-2-oxopyrimidin-4-yl]piperazine-1-carboxamide.
| Compound Name | 4-(2-amino-3-hydroxypropanoyl)-N-[1-(4-formylphenyl)-2-oxopyrimidin-4-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 154651071 |
| Molecular Formula | C19H22N6O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-(2-amino-3-hydroxypropanoyl)-N-[1-(4-formylphenyl)-2-oxopyrimidin-4-yl]piperazine-1-carboxamide |
| SMILES | NC(CO)C(=O)N1CCN(C(=O)Nc2ccn(-c3ccc(C=O)cc3)c(=O)n2)CC1 |
| InChI | InChI=1S/C19H22N6O5/c20-15(12-27)17(28)23-7-9-24(10-8-23)18(29)21-16-5-6-25(19(30)22-16)14-3-1-13(11-26)2-4-14/h1-6,11,15,27H,7-10,12,20H2,(H,21,22,29,30) |
| InChIKey | SGDXSCDONKFPAT-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|