C21H24N6O6 — CID 175366229
[1-[4-[[1-(4-formylphenyl)-2-oxopyrimidin-4-yl]carbamoyl]piperazin-1-yl]-2-methyl-1-oxopropan-2-yl] carbamate (PubChem CID 175366229) has the molecular formula C21H24N6O6 and a molecular weight of 456.46 g/mol. Its IUPAC name is [1-[4-[[1-(4-formylphenyl)-2-oxopyrimidin-4-yl]carbamoyl]piperazin-1-yl]-2-methyl-1-oxopropan-2-yl] carbamate.
| Compound Name | [1-[4-[[1-(4-formylphenyl)-2-oxopyrimidin-4-yl]carbamoyl]piperazin-1-yl]-2-methyl-1-oxopropan-2-yl] carbamate |
|---|---|
| PubChem CID | 175366229 |
| Molecular Formula | C21H24N6O6 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | [1-[4-[[1-(4-formylphenyl)-2-oxopyrimidin-4-yl]carbamoyl]piperazin-1-yl]-2-methyl-1-oxopropan-2-yl] carbamate |
| SMILES | CC(C)(OC(N)=O)C(=O)N1CCN(C(=O)Nc2ccn(-c3ccc(C=O)cc3)c(=O)n2)CC1 |
| InChI | InChI=1S/C21H24N6O6/c1-21(2,33-18(22)30)17(29)25-9-11-26(12-10-25)19(31)23-16-7-8-27(20(32)24-16)15-5-3-14(13-28)4-6-15/h3-8,13H,9-12H2,1-2H3,(H2,22,30)(H,23,24,31,32) |
| InChIKey | DOYCQSQNLYNZKE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 156.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|