About N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole
N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole (PubChem CID 154653071) has the molecular formula C24H28N4O
and a molecular weight of 388.51 g/mol. Its IUPAC name is N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole.
Molecular Properties
| Compound Name | N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole |
| PubChem CID | 154653071 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole |
| SMILES | CN(C(=O)c1ccc(-c2ccccc2)cc1)C1CCCC1.c1n[nH]nc1C1CC1 |
| InChI | InChI=1S/C19H21NO.C5H7N3/c1-20(18-9-5-6-10-18)19(21)17-13-11-16(12-14-17)15-7-3-2-4-8-15;1-2-4(1)5-3-6-8-7-5/h2-4,7-8,11-14,18H,5-6,9-10H2,1H3;3-4H,1-2H2,(H,6,7,8) |
| InChIKey | YOJJALQICDOTRO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole?
The IUPAC name of N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole (CID 154653071) is N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole.
What is the SMILES notation for N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole?
The canonical SMILES for N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole is CN(C(=O)c1ccc(-c2ccccc2)cc1)C1CCCC1.c1n[nH]nc1C1CC1.
What is the InChIKey of N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole?
The InChIKey is YOJJALQICDOTRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO.C5H7N3/c1-20(18-9-5-6-10-18)19(21)17-13-11-16(12-14-17)15-7-3-2-4-8-15;1-2-4(1)5-3-6-8-7-5/h2-4,7-8,11-14,18H,5-6,9-10H2,1H3;3-4H,1-2H2,(H,6,7,8).
What are the key properties of N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole?
N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole has a molecular weight of 388.51 g/mol, XLogP of 5.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-N-methyl-4-phenylbenzamide;4-cyclopropyl-2H-triazole is sourced from PubChem (CID 154653071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).