C21H31N5 — CID 154654183
5-[1-(7-methyloctan-4-ylamino)ethenyl]-N-(1-pyridin-3-ylethenyl)-1H-pyrazol-4-amine (PubChem CID 154654183) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is 5-[1-(7-methyloctan-4-ylamino)ethenyl]-N-(1-pyridin-3-ylethenyl)-1H-pyrazol-4-amine.
| Compound Name | 5-[1-(7-methyloctan-4-ylamino)ethenyl]-N-(1-pyridin-3-ylethenyl)-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 154654183 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 5-[1-(7-methyloctan-4-ylamino)ethenyl]-N-(1-pyridin-3-ylethenyl)-1H-pyrazol-4-amine |
| SMILES | C=C(Nc1cn[nH]c1C(=C)NC(CCC)CCC(C)C)c1cccnc1 |
| InChI | InChI=1S/C21H31N5/c1-6-8-19(11-10-15(2)3)24-17(5)21-20(14-23-26-21)25-16(4)18-9-7-12-22-13-18/h7,9,12-15,19,24-25H,4-6,8,10-11H2,1-3H3,(H,23,26) |
| InChIKey | YLVYZMVCVAHTDV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |