C19H22N6 — CID 155010064
N-[1-[4-[[4-(dimethylamino)phenyl]methylamino]-1H-pyrazol-5-yl]ethenyl]pyridin-3-amine (PubChem CID 155010064) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is N-[1-[4-[[4-(dimethylamino)phenyl]methylamino]-1H-pyrazol-5-yl]ethenyl]pyridin-3-amine.
| Compound Name | N-[1-[4-[[4-(dimethylamino)phenyl]methylamino]-1H-pyrazol-5-yl]ethenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 155010064 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[1-[4-[[4-(dimethylamino)phenyl]methylamino]-1H-pyrazol-5-yl]ethenyl]pyridin-3-amine |
| SMILES | C=C(Nc1cccnc1)c1[nH]ncc1NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H22N6/c1-14(23-16-5-4-10-20-12-16)19-18(13-22-24-19)21-11-15-6-8-17(9-7-15)25(2)3/h4-10,12-13,21,23H,1,11H2,2-3H3,(H,22,24) |
| InChIKey | OOCWLHGPUJXRPO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|