C27H29N5 — CID 154655020
5-[4-amino-3-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)phenyl]-N-(1-cyclohexylethenyl)pyridin-3-amine (PubChem CID 154655020) has the molecular formula C27H29N5 and a molecular weight of 423.56 g/mol. Its IUPAC name is 5-[4-amino-3-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)phenyl]-N-(1-cyclohexylethenyl)pyridin-3-amine.
| Compound Name | 5-[4-amino-3-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)phenyl]-N-(1-cyclohexylethenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 154655020 |
| Molecular Formula | C27H29N5 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 5-[4-amino-3-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)phenyl]-N-(1-cyclohexylethenyl)pyridin-3-amine |
| SMILES | C=C(Nc1cncc(-c2ccc(N)c(Cc3cc4cnccc4[nH]3)c2)c1)C1CCCCC1 |
| InChI | InChI=1S/C27H29N5/c1-18(19-5-3-2-4-6-19)31-25-13-22(15-30-17-25)20-7-8-26(28)21(11-20)12-24-14-23-16-29-10-9-27(23)32-24/h7-11,13-17,19,31-32H,1-6,12,28H2 |
| InChIKey | PEQCPINVPSPMBS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|