C14H13ClF2N4O2 — CID 154655469
N-(6-amino-5-chloro-4-ethoxy-3-pyridinyl)-6-(difluoromethyl)pyridine-2-carboxamide (PubChem CID 154655469) has the molecular formula C14H13ClF2N4O2 and a molecular weight of 342.73 g/mol. Its IUPAC name is N-(6-amino-5-chloro-4-ethoxy-3-pyridinyl)-6-(difluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(6-amino-5-chloro-4-ethoxy-3-pyridinyl)-6-(difluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 154655469 |
| Molecular Formula | C14H13ClF2N4O2 |
| Molecular Weight | 342.73 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-(6-amino-5-chloro-4-ethoxy-3-pyridinyl)-6-(difluoromethyl)pyridine-2-carboxamide |
| SMILES | CCOc1c(NC(=O)c2cccc(C(F)F)n2)cnc(N)c1Cl |
| InChI | InChI=1S/C14H13ClF2N4O2/c1-2-23-11-9(6-19-13(18)10(11)15)21-14(22)8-5-3-4-7(20-8)12(16)17/h3-6,12H,2H2,1H3,(H2,18,19)(H,21,22) |
| InChIKey | MBWNBQUCKJINFW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |