C17H14F2N4O3 — CID 172721526
methyl 5-[[6-(difluoromethyl)pyridine-2-carbonyl]amino]-1-methylindazole-6-carboxylate (PubChem CID 172721526) has the molecular formula C17H14F2N4O3 and a molecular weight of 360.32 g/mol. Its IUPAC name is methyl 5-[[6-(difluoromethyl)pyridine-2-carbonyl]amino]-1-methylindazole-6-carboxylate.
| Compound Name | methyl 5-[[6-(difluoromethyl)pyridine-2-carbonyl]amino]-1-methylindazole-6-carboxylate |
|---|---|
| PubChem CID | 172721526 |
| Molecular Formula | C17H14F2N4O3 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | methyl 5-[[6-(difluoromethyl)pyridine-2-carbonyl]amino]-1-methylindazole-6-carboxylate |
| SMILES | COC(=O)c1cc2c(cnn2C)cc1NC(=O)c1cccc(C(F)F)n1 |
| InChI | InChI=1S/C17H14F2N4O3/c1-23-14-7-10(17(25)26-2)13(6-9(14)8-20-23)22-16(24)12-5-3-4-11(21-12)15(18)19/h3-8,15H,1-2H3,(H,22,24) |
| InChIKey | GOQZXXODFUONGP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |