C27H25ClFN5O — CID 154656265
5-(8-chloroquinolin-6-yl)-6-(4-fluorophenyl)-3-[(Z)-3-methyliminohept-4-en-2-yl]oxypyrazin-2-amine (PubChem CID 154656265) has the molecular formula C27H25ClFN5O and a molecular weight of 489.98 g/mol. Its IUPAC name is 5-(8-chloroquinolin-6-yl)-6-(4-fluorophenyl)-3-[(Z)-3-methyliminohept-4-en-2-yl]oxypyrazin-2-amine.
| Compound Name | 5-(8-chloroquinolin-6-yl)-6-(4-fluorophenyl)-3-[(Z)-3-methyliminohept-4-en-2-yl]oxypyrazin-2-amine |
|---|---|
| PubChem CID | 154656265 |
| Molecular Formula | C27H25ClFN5O |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 5-(8-chloroquinolin-6-yl)-6-(4-fluorophenyl)-3-[(Z)-3-methyliminohept-4-en-2-yl]oxypyrazin-2-amine |
| SMILES | CC/C=C\C(=N/C)C(C)Oc1nc(-c2cc(Cl)c3ncccc3c2)c(-c2ccc(F)cc2)nc1N |
| InChI | InChI=1S/C27H25ClFN5O/c1-4-5-8-22(31-3)16(2)35-27-26(30)33-24(17-9-11-20(29)12-10-17)25(34-27)19-14-18-7-6-13-32-23(18)21(28)15-19/h5-16H,4H2,1-3H3,(H2,30,33)/b8-5-,31-22+ |
| InChIKey | DJIYCECUXQPONG-UGOQTEHFSA-N |
| XLogP | 6.54 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|