C27H26ClFN6O — CID 154656328
N'-[(Z)-2-amino-2-(8-chloroquinolin-6-yl)-1-(4-fluorophenyl)ethenyl]-3-pyridin-2-ylbutanimidamide;formamide (PubChem CID 154656328) has the molecular formula C27H26ClFN6O and a molecular weight of 505.00 g/mol. Its IUPAC name is N'-[(Z)-2-amino-2-(8-chloroquinolin-6-yl)-1-(4-fluorophenyl)ethenyl]-3-pyridin-2-ylbutanimidamide;formamide.
| Compound Name | N'-[(Z)-2-amino-2-(8-chloroquinolin-6-yl)-1-(4-fluorophenyl)ethenyl]-3-pyridin-2-ylbutanimidamide;formamide |
|---|---|
| PubChem CID | 154656328 |
| Molecular Formula | C27H26ClFN6O |
| Molecular Weight | 505.00 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | N'-[(Z)-2-amino-2-(8-chloroquinolin-6-yl)-1-(4-fluorophenyl)ethenyl]-3-pyridin-2-ylbutanimidamide;formamide |
| SMILES | CC(C/C(N)=N\C(=C(/N)c1cc(Cl)c2ncccc2c1)c1ccc(F)cc1)c1ccccn1.NC=O |
| InChI | InChI=1S/C26H23ClFN5.CH3NO/c1-16(22-6-2-3-11-31-22)13-23(29)33-26(17-7-9-20(28)10-8-17)24(30)19-14-18-5-4-12-32-25(18)21(27)15-19;2-1-3/h2-12,14-16H,13,30H2,1H3,(H2,29,33);1H,(H2,2,3)/b26-24-; |
| InChIKey | AXTJUXJWIFCGCX-FSKGQQLBSA-N |
| XLogP | 4.86 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.00 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|