C24H17ClN4O2S — CID 154656926
2-(8-chloroquinolin-6-yl)-7-ethylsulfinyl-3-phenyl-5H-pyrido[2,3-b]pyrazin-8-one (PubChem CID 154656926) has the molecular formula C24H17ClN4O2S and a molecular weight of 460.95 g/mol. Its IUPAC name is 2-(8-chloroquinolin-6-yl)-7-ethylsulfinyl-3-phenyl-5H-pyrido[2,3-b]pyrazin-8-one.
| Compound Name | 2-(8-chloroquinolin-6-yl)-7-ethylsulfinyl-3-phenyl-5H-pyrido[2,3-b]pyrazin-8-one |
|---|---|
| PubChem CID | 154656926 |
| Molecular Formula | C24H17ClN4O2S |
| Molecular Weight | 460.95 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 2-(8-chloroquinolin-6-yl)-7-ethylsulfinyl-3-phenyl-5H-pyrido[2,3-b]pyrazin-8-one |
| SMILES | CCS(=O)c1c[nH]c2nc(-c3ccccc3)c(-c3cc(Cl)c4ncccc4c3)nc2c1=O |
| InChI | InChI=1S/C24H17ClN4O2S/c1-2-32(31)18-13-27-24-22(23(18)30)28-21(20(29-24)14-7-4-3-5-8-14)16-11-15-9-6-10-26-19(15)17(25)12-16/h3-13H,2H2,1H3,(H,27,29,30) |
| InChIKey | ZZNLUTSNZGAKHB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.95 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |