C26H19ClN4O2S — CID 155006971
7-(benzenesulfinylmethyl)-2-(2-chloro-6-methyl-4-pyridinyl)-3-phenyl-5H-pyrido[2,3-b]pyrazin-8-one (PubChem CID 155006971) has the molecular formula C26H19ClN4O2S and a molecular weight of 486.98 g/mol. Its IUPAC name is 7-(benzenesulfinylmethyl)-2-(2-chloro-6-methyl-4-pyridinyl)-3-phenyl-5H-pyrido[2,3-b]pyrazin-8-one.
| Compound Name | 7-(benzenesulfinylmethyl)-2-(2-chloro-6-methyl-4-pyridinyl)-3-phenyl-5H-pyrido[2,3-b]pyrazin-8-one |
|---|---|
| PubChem CID | 155006971 |
| Molecular Formula | C26H19ClN4O2S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 7-(benzenesulfinylmethyl)-2-(2-chloro-6-methyl-4-pyridinyl)-3-phenyl-5H-pyrido[2,3-b]pyrazin-8-one |
| SMILES | Cc1cc(-c2nc3c(=O)c(CS(=O)c4ccccc4)c[nH]c3nc2-c2ccccc2)cc(Cl)n1 |
| InChI | InChI=1S/C26H19ClN4O2S/c1-16-12-18(13-21(27)29-16)23-22(17-8-4-2-5-9-17)31-26-24(30-23)25(32)19(14-28-26)15-34(33)20-10-6-3-7-11-20/h2-14H,15H2,1H3,(H,28,31,32) |
| InChIKey | NYOYQVWGELTRAJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|