C20H13ClFN3O — CID 137438945
6-(2-chloro-6-methyl-4-pyridinyl)-3-fluoro-7-phenyl-1H-1,8-naphthyridin-4-one (PubChem CID 137438945) has the molecular formula C20H13ClFN3O and a molecular weight of 365.80 g/mol. Its IUPAC name is 6-(2-chloro-6-methyl-4-pyridinyl)-3-fluoro-7-phenyl-1H-1,8-naphthyridin-4-one.
| Compound Name | 6-(2-chloro-6-methyl-4-pyridinyl)-3-fluoro-7-phenyl-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 137438945 |
| Molecular Formula | C20H13ClFN3O |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 6-(2-chloro-6-methyl-4-pyridinyl)-3-fluoro-7-phenyl-1H-1,8-naphthyridin-4-one |
| SMILES | Cc1cc(-c2cc3c(=O)c(F)c[nH]c3nc2-c2ccccc2)cc(Cl)n1 |
| InChI | InChI=1S/C20H13ClFN3O/c1-11-7-13(8-17(21)24-11)14-9-15-19(26)16(22)10-23-20(15)25-18(14)12-5-3-2-4-6-12/h2-10H,1H3,(H,23,25,26) |
| InChIKey | OTAKFNCMFTUMEI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|