C27H20ClN3O2 — CID 137438387
6-(2-chloro-6-methyl-4-pyridinyl)-2-(phenoxymethyl)-7-phenyl-1H-1,8-naphthyridin-4-one (PubChem CID 137438387) has the molecular formula C27H20ClN3O2 and a molecular weight of 453.93 g/mol. Its IUPAC name is 6-(2-chloro-6-methyl-4-pyridinyl)-2-(phenoxymethyl)-7-phenyl-1H-1,8-naphthyridin-4-one.
| Compound Name | 6-(2-chloro-6-methyl-4-pyridinyl)-2-(phenoxymethyl)-7-phenyl-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 137438387 |
| Molecular Formula | C27H20ClN3O2 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 6-(2-chloro-6-methyl-4-pyridinyl)-2-(phenoxymethyl)-7-phenyl-1H-1,8-naphthyridin-4-one |
| SMILES | Cc1cc(-c2cc3c(=O)cc(COc4ccccc4)[nH]c3nc2-c2ccccc2)cc(Cl)n1 |
| InChI | InChI=1S/C27H20ClN3O2/c1-17-12-19(13-25(28)29-17)22-15-23-24(32)14-20(16-33-21-10-6-3-7-11-21)30-27(23)31-26(22)18-8-4-2-5-9-18/h2-15H,16H2,1H3,(H,30,31,32) |
| InChIKey | ZEXZDJVJLLZUQE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|