C31H32ClN5O2S — CID 154657123
2-(2-chloro-6-methyl-4-pyridinyl)-8-oxo-3-phenyl-5H-pyrido[2,3-b]pyrazine-7-carbaldehyde;ethane;N-[(3-methylphenyl)methylsulfanyl]methanamine (PubChem CID 154657123) has the molecular formula C31H32ClN5O2S and a molecular weight of 574.15 g/mol. Its IUPAC name is 2-(2-chloro-6-methyl-4-pyridinyl)-8-oxo-3-phenyl-5H-pyrido[2,3-b]pyrazine-7-carbaldehyde;ethane;N-[(3-methylphenyl)methylsulfanyl]methanamine.
| Compound Name | 2-(2-chloro-6-methyl-4-pyridinyl)-8-oxo-3-phenyl-5H-pyrido[2,3-b]pyrazine-7-carbaldehyde;ethane;N-[(3-methylphenyl)methylsulfanyl]methanamine |
|---|---|
| PubChem CID | 154657123 |
| Molecular Formula | C31H32ClN5O2S |
| Molecular Weight | 574.15 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 2-(2-chloro-6-methyl-4-pyridinyl)-8-oxo-3-phenyl-5H-pyrido[2,3-b]pyrazine-7-carbaldehyde;ethane;N-[(3-methylphenyl)methylsulfanyl]methanamine |
| SMILES | CC.CNSCc1cccc(C)c1.Cc1cc(-c2nc3c(=O)c(C=O)c[nH]c3nc2-c2ccccc2)cc(Cl)n1 |
| InChI | InChI=1S/C20H13ClN4O2.C9H13NS.C2H6/c1-11-7-13(8-15(21)23-11)17-16(12-5-3-2-4-6-12)25-20-18(24-17)19(27)14(10-26)9-22-20;1-8-4-3-5-9(6-8)7-11-10-2;1-2/h2-10H,1H3,(H,22,25,27);3-6,10H,7H2,1-2H3;1-2H3 |
| InChIKey | BAOGXONMTVZFCB-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.15 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|