C22H14ClN5OS — CID 154657423
3-[2-(7-chloro-2,3-dihydro-1,2-benzothiazol-5-yl)-8-oxo-5H-pyrido[2,3-b]pyrazin-3-yl]-2-methylbenzonitrile (PubChem CID 154657423) has the molecular formula C22H14ClN5OS and a molecular weight of 431.91 g/mol. Its IUPAC name is 3-[2-(7-chloro-2,3-dihydro-1,2-benzothiazol-5-yl)-8-oxo-5H-pyrido[2,3-b]pyrazin-3-yl]-2-methylbenzonitrile.
| Compound Name | 3-[2-(7-chloro-2,3-dihydro-1,2-benzothiazol-5-yl)-8-oxo-5H-pyrido[2,3-b]pyrazin-3-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 154657423 |
| Molecular Formula | C22H14ClN5OS |
| Molecular Weight | 431.91 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 3-[2-(7-chloro-2,3-dihydro-1,2-benzothiazol-5-yl)-8-oxo-5H-pyrido[2,3-b]pyrazin-3-yl]-2-methylbenzonitrile |
| SMILES | Cc1c(C#N)cccc1-c1nc2[nH]ccc(=O)c2nc1-c1cc(Cl)c2c(c1)CNS2 |
| InChI | InChI=1S/C22H14ClN5OS/c1-11-12(9-24)3-2-4-15(11)19-18(27-20-17(29)5-6-25-22(20)28-19)13-7-14-10-26-30-21(14)16(23)8-13/h2-8,26H,10H2,1H3,(H,25,28,29) |
| InChIKey | UTQLCMHQLQAZMM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|