C30H26ClFN8O — CID 154657865
2-[6-[[[(2E)-2-[3-amino-6-(8-chloroquinolin-6-yl)-5-(4-fluorophenyl)pyrazin-2-yl]-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]propan-2-ol (PubChem CID 154657865) has the molecular formula C30H26ClFN8O and a molecular weight of 569.04 g/mol. Its IUPAC name is 2-[6-[[[(2E)-2-[3-amino-6-(8-chloroquinolin-6-yl)-5-(4-fluorophenyl)pyrazin-2-yl]-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]propan-2-ol.
| Compound Name | 2-[6-[[[(2E)-2-[3-amino-6-(8-chloroquinolin-6-yl)-5-(4-fluorophenyl)pyrazin-2-yl]-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 154657865 |
| Molecular Formula | C30H26ClFN8O |
| Molecular Weight | 569.04 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 2-[6-[[[(2E)-2-[3-amino-6-(8-chloroquinolin-6-yl)-5-(4-fluorophenyl)pyrazin-2-yl]-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]propan-2-ol |
| SMILES | CC(C)(O)c1cccc(C/N=C/C(=N\N)c2nc(-c3cc(Cl)c4ncccc4c3)c(-c3ccc(F)cc3)nc2N)n1 |
| InChI | InChI=1S/C30H26ClFN8O/c1-30(2,41)24-7-3-6-21(37-24)15-35-16-23(40-34)28-29(33)39-26(17-8-10-20(32)11-9-17)27(38-28)19-13-18-5-4-12-36-25(18)22(31)14-19/h3-14,16,41H,15,34H2,1-2H3,(H2,33,39)/b35-16+,40-23+ |
| InChIKey | CWXJPVOJRNOZGS-FTLHNZQTSA-N |
| XLogP | 5.29 |
| TPSA | 148.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.04 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|