C25H17Cl2FN4O — CID 163993690
(S)-(2,4-dichloro-3-phenylquinolin-6-yl)-(2-fluoro-4-pyridinyl)-(1-methylimidazol-2-yl)methanol (PubChem CID 163993690) has the molecular formula C25H17Cl2FN4O and a molecular weight of 479.34 g/mol. Its IUPAC name is (S)-(2,4-dichloro-3-phenylquinolin-6-yl)-(2-fluoro-4-pyridinyl)-(1-methylimidazol-2-yl)methanol.
| Compound Name | (S)-(2,4-dichloro-3-phenylquinolin-6-yl)-(2-fluoro-4-pyridinyl)-(1-methylimidazol-2-yl)methanol |
|---|---|
| PubChem CID | 163993690 |
| Molecular Formula | C25H17Cl2FN4O |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | (S)-(2,4-dichloro-3-phenylquinolin-6-yl)-(2-fluoro-4-pyridinyl)-(1-methylimidazol-2-yl)methanol |
| SMILES | Cn1ccnc1[C@@](O)(c1ccnc(F)c1)c1ccc2nc(Cl)c(-c3ccccc3)c(Cl)c2c1 |
| InChI | InChI=1S/C25H17Cl2FN4O/c1-32-12-11-30-24(32)25(33,17-9-10-29-20(28)14-17)16-7-8-19-18(13-16)22(26)21(23(27)31-19)15-5-3-2-4-6-15/h2-14,33H,1H3/t25-/m0/s1 |
| InChIKey | UCUWSCFHYLUMMT-VWLOTQADSA-N |
| XLogP | 5.76 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|