C25H24N8O3S — CID 154658244
6-(1-methylpyrazol-3-yl)-3-[2-[(5-methylsulfonyl-3-pyridinyl)amino]ethoxy]-5-quinolin-6-ylpyrazin-2-amine (PubChem CID 154658244) has the molecular formula C25H24N8O3S and a molecular weight of 516.59 g/mol. Its IUPAC name is 6-(1-methylpyrazol-3-yl)-3-[2-[(5-methylsulfonyl-3-pyridinyl)amino]ethoxy]-5-quinolin-6-ylpyrazin-2-amine.
| Compound Name | 6-(1-methylpyrazol-3-yl)-3-[2-[(5-methylsulfonyl-3-pyridinyl)amino]ethoxy]-5-quinolin-6-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 154658244 |
| Molecular Formula | C25H24N8O3S |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 6-(1-methylpyrazol-3-yl)-3-[2-[(5-methylsulfonyl-3-pyridinyl)amino]ethoxy]-5-quinolin-6-ylpyrazin-2-amine |
| SMILES | Cn1ccc(-c2nc(N)c(OCCNc3cncc(S(C)(=O)=O)c3)nc2-c2ccc3ncccc3c2)n1 |
| InChI | InChI=1S/C25H24N8O3S/c1-33-10-7-21(32-33)23-22(17-5-6-20-16(12-17)4-3-8-29-20)31-25(24(26)30-23)36-11-9-28-18-13-19(15-27-14-18)37(2,34)35/h3-8,10,12-15,28H,9,11H2,1-2H3,(H2,26,30) |
| InChIKey | YFIKSUPTXWFFRV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 150.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|