C25H25N9OS — CID 154658290
3-N-[2-[3-amino-5-(1-methylpyrazol-3-yl)-6-quinolin-6-ylpyrazin-2-yl]oxyethyl]-5-N-methylsulfanylpyridine-3,5-diamine (PubChem CID 154658290) has the molecular formula C25H25N9OS and a molecular weight of 499.60 g/mol. Its IUPAC name is 3-N-[2-[3-amino-5-(1-methylpyrazol-3-yl)-6-quinolin-6-ylpyrazin-2-yl]oxyethyl]-5-N-methylsulfanylpyridine-3,5-diamine.
| Compound Name | 3-N-[2-[3-amino-5-(1-methylpyrazol-3-yl)-6-quinolin-6-ylpyrazin-2-yl]oxyethyl]-5-N-methylsulfanylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 154658290 |
| Molecular Formula | C25H25N9OS |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 3-N-[2-[3-amino-5-(1-methylpyrazol-3-yl)-6-quinolin-6-ylpyrazin-2-yl]oxyethyl]-5-N-methylsulfanylpyridine-3,5-diamine |
| SMILES | CSNc1cncc(NCCOc2nc(-c3ccc4ncccc4c3)c(-c3ccn(C)n3)nc2N)c1 |
| InChI | InChI=1S/C25H25N9OS/c1-34-10-7-21(32-34)23-22(17-5-6-20-16(12-17)4-3-8-29-20)31-25(24(26)30-23)35-11-9-28-18-13-19(33-36-2)15-27-14-18/h3-8,10,12-15,28,33H,9,11H2,1-2H3,(H2,26,30) |
| InChIKey | LEHFTYNEIFLPID-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 128.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|