About ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene
ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene (PubChem CID 154661383) has the molecular formula C23H38O3
and a molecular weight of 362.55 g/mol. Its IUPAC name is ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene.
Molecular Properties
| Compound Name | ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene |
| PubChem CID | 154661383 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene |
| SMILES | CC.CC.CCOCC(O)c1ccccc1.COCCc1ccccc1 |
| InChI | InChI=1S/C10H14O2.C9H12O.2C2H6/c1-2-12-8-10(11)9-6-4-3-5-7-9;1-10-8-7-9-5-3-2-4-6-9;2*1-2/h3-7,10-11H,2,8H2,1H3;2-6H,7-8H2,1H3;2*1-2H3 |
| InChIKey | LJPZXAJVBHUYFN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene?
The IUPAC name of ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene (CID 154661383) is ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene.
What is the SMILES notation for ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene?
The canonical SMILES for ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene is CC.CC.CCOCC(O)c1ccccc1.COCCc1ccccc1.
What is the InChIKey of ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene?
The InChIKey is LJPZXAJVBHUYFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2.C9H12O.2C2H6/c1-2-12-8-10(11)9-6-4-3-5-7-9;1-10-8-7-9-5-3-2-4-6-9;2*1-2/h3-7,10-11H,2,8H2,1H3;2-6H,7-8H2,1H3;2*1-2H3.
What are the key properties of ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene?
ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene has a molecular weight of 362.55 g/mol, XLogP of 5.68, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethoxy-1-phenylethanol;2-methoxyethylbenzene is sourced from PubChem (CID 154661383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).