C26H32N4O — CID 154664525
1-(4-cyanophenyl)-N-[3-(6-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propyl]piperidine-4-carboxamide (PubChem CID 154664525) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-N-[3-(6-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-cyanophenyl)-N-[3-(6-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 154664525 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 1-(4-cyanophenyl)-N-[3-(6-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc2c(c1)CCN(CCCNC(=O)C1CCN(c3ccc(C#N)cc3)CC1)C2 |
| InChI | InChI=1S/C26H32N4O/c1-20-3-6-24-19-29(14-9-23(24)17-20)13-2-12-28-26(31)22-10-15-30(16-11-22)25-7-4-21(18-27)5-8-25/h3-8,17,22H,2,9-16,19H2,1H3,(H,28,31) |
| InChIKey | ZGDODDBAQJFJHC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|