C24H27F3N2OS — CID 154665487
cyclopropyl-[4-fluoro-2-[[2-fluoro-3-(3-fluorophenyl)phenyl]methyl]-3-(propylsulfanylamino)pyrrolidin-1-yl]methanone (PubChem CID 154665487) has the molecular formula C24H27F3N2OS and a molecular weight of 448.55 g/mol. Its IUPAC name is cyclopropyl-[4-fluoro-2-[[2-fluoro-3-(3-fluorophenyl)phenyl]methyl]-3-(propylsulfanylamino)pyrrolidin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-fluoro-2-[[2-fluoro-3-(3-fluorophenyl)phenyl]methyl]-3-(propylsulfanylamino)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 154665487 |
| Molecular Formula | C24H27F3N2OS |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | cyclopropyl-[4-fluoro-2-[[2-fluoro-3-(3-fluorophenyl)phenyl]methyl]-3-(propylsulfanylamino)pyrrolidin-1-yl]methanone |
| SMILES | CCCSNC1C(F)CN(C(=O)C2CC2)C1Cc1cccc(-c2cccc(F)c2)c1F |
| InChI | InChI=1S/C24H27F3N2OS/c1-2-11-31-28-23-20(26)14-29(24(30)15-9-10-15)21(23)13-17-6-4-8-19(22(17)27)16-5-3-7-18(25)12-16/h3-8,12,15,20-21,23,28H,2,9-11,13-14H2,1H3 |
| InChIKey | KQCVKRVSJFPQQC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|