C18H19F3N2 — CID 154665160
4-fluoro-2-[[2-fluoro-3-(3-fluorophenyl)phenyl]methyl]-1-methylpyrrolidin-3-amine (PubChem CID 154665160) has the molecular formula C18H19F3N2 and a molecular weight of 320.36 g/mol. Its IUPAC name is 4-fluoro-2-[[2-fluoro-3-(3-fluorophenyl)phenyl]methyl]-1-methylpyrrolidin-3-amine.
| Compound Name | 4-fluoro-2-[[2-fluoro-3-(3-fluorophenyl)phenyl]methyl]-1-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 154665160 |
| Molecular Formula | C18H19F3N2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-fluoro-2-[[2-fluoro-3-(3-fluorophenyl)phenyl]methyl]-1-methylpyrrolidin-3-amine |
| SMILES | CN1CC(F)C(N)C1Cc1cccc(-c2cccc(F)c2)c1F |
| InChI | InChI=1S/C18H19F3N2/c1-23-10-15(20)18(22)16(23)9-12-5-3-7-14(17(12)21)11-4-2-6-13(19)8-11/h2-8,15-16,18H,9-10,22H2,1H3 |
| InChIKey | FTOPAGDJLDQWOP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |