C20H25FN2 — CID 154665335
4-fluoro-1-methyl-2-[[2-methyl-3-(3-methylphenyl)phenyl]methyl]pyrrolidin-3-amine (PubChem CID 154665335) has the molecular formula C20H25FN2 and a molecular weight of 312.43 g/mol. Its IUPAC name is 4-fluoro-1-methyl-2-[[2-methyl-3-(3-methylphenyl)phenyl]methyl]pyrrolidin-3-amine.
| Compound Name | 4-fluoro-1-methyl-2-[[2-methyl-3-(3-methylphenyl)phenyl]methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 154665335 |
| Molecular Formula | C20H25FN2 |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 4-fluoro-1-methyl-2-[[2-methyl-3-(3-methylphenyl)phenyl]methyl]pyrrolidin-3-amine |
| SMILES | Cc1cccc(-c2cccc(CC3C(N)C(F)CN3C)c2C)c1 |
| InChI | InChI=1S/C20H25FN2/c1-13-6-4-8-16(10-13)17-9-5-7-15(14(17)2)11-19-20(22)18(21)12-23(19)3/h4-10,18-20H,11-12,22H2,1-3H3 |
| InChIKey | XOUFMXFRFZHKOY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |