C30H29F2N7O — CID 154665595
4-[3-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-2-fluorophenyl]-7-(3-aminopiperidin-1-yl)imidazo[4,5-b]pyridin-2-yl]-2-fluorobenzonitrile (PubChem CID 154665595) has the molecular formula C30H29F2N7O and a molecular weight of 541.61 g/mol. Its IUPAC name is 4-[3-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-2-fluorophenyl]-7-(3-aminopiperidin-1-yl)imidazo[4,5-b]pyridin-2-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[3-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-2-fluorophenyl]-7-(3-aminopiperidin-1-yl)imidazo[4,5-b]pyridin-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 154665595 |
| Molecular Formula | C30H29F2N7O |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 4-[3-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-2-fluorophenyl]-7-(3-aminopiperidin-1-yl)imidazo[4,5-b]pyridin-2-yl]-2-fluorobenzonitrile |
| SMILES | N#Cc1ccc(-c2nc3c(N4CCCC(N)C4)ccnc3n2-c2ccc(N3CC4COCC4C3)cc2F)cc1F |
| InChI | InChI=1S/C30H29F2N7O/c31-24-10-18(3-4-19(24)12-33)29-36-28-27(37-9-1-2-22(34)15-37)7-8-35-30(28)39(29)26-6-5-23(11-25(26)32)38-13-20-16-40-17-21(20)14-38/h3-8,10-11,20-22H,1-2,9,13-17,34H2 |
| InChIKey | VQWHVGONPDEJHY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |