C30H33FN6 — CID 154698659
4-[7-[(3R)-3-aminopiperidin-1-yl]-3-(4-hexylphenyl)imidazo[4,5-b]pyridin-2-yl]-2-fluorobenzonitrile (PubChem CID 154698659) has the molecular formula C30H33FN6 and a molecular weight of 496.63 g/mol. Its IUPAC name is 4-[7-[(3R)-3-aminopiperidin-1-yl]-3-(4-hexylphenyl)imidazo[4,5-b]pyridin-2-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[7-[(3R)-3-aminopiperidin-1-yl]-3-(4-hexylphenyl)imidazo[4,5-b]pyridin-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 154698659 |
| Molecular Formula | C30H33FN6 |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 4-[7-[(3R)-3-aminopiperidin-1-yl]-3-(4-hexylphenyl)imidazo[4,5-b]pyridin-2-yl]-2-fluorobenzonitrile |
| SMILES | CCCCCCc1ccc(-n2c(-c3ccc(C#N)c(F)c3)nc3c(N4CCC[C@@H](N)C4)ccnc32)cc1 |
| InChI | InChI=1S/C30H33FN6/c1-2-3-4-5-7-21-9-13-25(14-10-21)37-29(22-11-12-23(19-32)26(31)18-22)35-28-27(15-16-34-30(28)37)36-17-6-8-24(33)20-36/h9-16,18,24H,2-8,17,20,33H2,1H3/t24-/m1/s1 |
| InChIKey | LSMKCOFUBRSSSD-XMMPIXPASA-N |
| XLogP | 6.15 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|