C14H22O2 — CID 154666844
methyl 3,4-dimethyl-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate;molecular hydrogen (PubChem CID 154666844) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is methyl 3,4-dimethyl-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate;molecular hydrogen.
| Compound Name | methyl 3,4-dimethyl-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate;molecular hydrogen |
|---|---|
| PubChem CID | 154666844 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | methyl 3,4-dimethyl-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate;molecular hydrogen |
| SMILES | COC(=O)C1=CC(C)C(C)C2=C1CCCC2.[H][H] |
| InChI | InChI=1S/C14H20O2.H2/c1-9-8-13(14(15)16-3)12-7-5-4-6-11(12)10(9)2;/h8-10H,4-7H2,1-3H3;1H |
| InChIKey | VEDUCTBOHGSSDA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |