About 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one
5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one (PubChem CID 154667161) has the molecular formula C26H24F2N2O2
and a molecular weight of 434.49 g/mol. Its IUPAC name is 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one |
| PubChem CID | 154667161 |
| Molecular Formula | C26H24F2N2O2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one |
| SMILES | CCN1Cc2cc(-c3cccc4cc(C(=O)N5CCC(F)(F)CC5)ccc34)ccc2C1=O |
| InChI | InChI=1S/C26H24F2N2O2/c1-2-29-16-20-15-18(6-9-23(20)25(29)32)21-5-3-4-17-14-19(7-8-22(17)21)24(31)30-12-10-26(27,28)11-13-30/h3-9,14-15H,2,10-13,16H2,1H3 |
| InChIKey | UJCANOCQQFVPPH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one?
The IUPAC name of 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one (CID 154667161) is 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one.
What is the SMILES notation for 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one?
The canonical SMILES for 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one is CCN1Cc2cc(-c3cccc4cc(C(=O)N5CCC(F)(F)CC5)ccc34)ccc2C1=O.
What is the InChIKey of 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one?
The InChIKey is UJCANOCQQFVPPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24F2N2O2/c1-2-29-16-20-15-18(6-9-23(20)25(29)32)21-5-3-4-17-14-19(7-8-22(17)21)24(31)30-12-10-26(27,28)11-13-30/h3-9,14-15H,2,10-13,16H2,1H3.
What are the key properties of 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one?
5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one has a molecular weight of 434.49 g/mol, XLogP of 5.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2-ethyl-3H-isoindol-1-one is sourced from PubChem (CID 154667161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).